C13H18F3NO3S — CID 115514527
2,3,5-trimethyl-4-(4,4,4-trifluorobutoxy)benzenesulfonamide (PubChem CID 115514527) has the molecular formula C13H18F3NO3S and a molecular weight of 325.35 g/mol. Its IUPAC name is 2,3,5-trimethyl-4-(4,4,4-trifluorobutoxy)benzenesulfonamide.
| Compound Name | 2,3,5-trimethyl-4-(4,4,4-trifluorobutoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 115514527 |
| Molecular Formula | C13H18F3NO3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2,3,5-trimethyl-4-(4,4,4-trifluorobutoxy)benzenesulfonamide |
| SMILES | Cc1cc(S(N)(=O)=O)c(C)c(C)c1OCCCC(F)(F)F |
| InChI | InChI=1S/C13H18F3NO3S/c1-8-7-11(21(17,18)19)9(2)10(3)12(8)20-6-4-5-13(14,15)16/h7H,4-6H2,1-3H3,(H2,17,18,19) |
| InChIKey | ZLEVBKJLQTXQRV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|