C11H13BrF3NO4S — CID 63214533
5-bromo-3-methyl-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzenesulfonamide (PubChem CID 63214533) has the molecular formula C11H13BrF3NO4S and a molecular weight of 392.19 g/mol. Its IUPAC name is 5-bromo-3-methyl-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzenesulfonamide.
| Compound Name | 5-bromo-3-methyl-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 63214533 |
| Molecular Formula | C11H13BrF3NO4S |
| Molecular Weight | 392.19 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | 5-bromo-3-methyl-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzenesulfonamide |
| SMILES | Cc1cc(Br)cc(S(N)(=O)=O)c1OCCOCC(F)(F)F |
| InChI | InChI=1S/C11H13BrF3NO4S/c1-7-4-8(12)5-9(21(16,17)18)10(7)20-3-2-19-6-11(13,14)15/h4-5H,2-3,6H2,1H3,(H2,16,17,18) |
| InChIKey | OXNYDRCKSSOEAF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|