C8H6BrClF3NO3S — CID 43164412
5-bromo-3-chloro-2-(2,2,2-trifluoroethoxy)benzenesulfonamide (PubChem CID 43164412) has the molecular formula C8H6BrClF3NO3S and a molecular weight of 368.56 g/mol. Its IUPAC name is 5-bromo-3-chloro-2-(2,2,2-trifluoroethoxy)benzenesulfonamide.
| Compound Name | 5-bromo-3-chloro-2-(2,2,2-trifluoroethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 43164412 |
| Molecular Formula | C8H6BrClF3NO3S |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 366.89 |
| IUPAC Name | 5-bromo-3-chloro-2-(2,2,2-trifluoroethoxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Br)cc(Cl)c1OCC(F)(F)F |
| InChI | InChI=1S/C8H6BrClF3NO3S/c9-4-1-5(10)7(17-3-8(11,12)13)6(2-4)18(14,15)16/h1-2H,3H2,(H2,14,15,16) |
| InChIKey | JOUFEPXDFXTCGO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |