C8H7BrF3NO3S — CID 62104800
5-bromo-2-(2,2,2-trifluoroethoxy)benzenesulfonamide (PubChem CID 62104800) has the molecular formula C8H7BrF3NO3S and a molecular weight of 334.11 g/mol. Its IUPAC name is 5-bromo-2-(2,2,2-trifluoroethoxy)benzenesulfonamide.
| Compound Name | 5-bromo-2-(2,2,2-trifluoroethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 62104800 |
| Molecular Formula | C8H7BrF3NO3S |
| Molecular Weight | 334.11 g/mol |
| Exact Mass | 332.93 |
| IUPAC Name | 5-bromo-2-(2,2,2-trifluoroethoxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Br)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C8H7BrF3NO3S/c9-5-1-2-6(16-4-8(10,11)12)7(3-5)17(13,14)15/h1-3H,4H2,(H2,13,14,15) |
| InChIKey | YTJZZXGMZYOBDC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.11 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |