C10H10BrNO3S — CID 82915032
5-bromo-2-but-3-ynoxybenzenesulfonamide (PubChem CID 82915032) has the molecular formula C10H10BrNO3S and a molecular weight of 304.17 g/mol. Its IUPAC name is 5-bromo-2-but-3-ynoxybenzenesulfonamide.
| Compound Name | 5-bromo-2-but-3-ynoxybenzenesulfonamide |
|---|---|
| PubChem CID | 82915032 |
| Molecular Formula | C10H10BrNO3S |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 302.96 |
| IUPAC Name | 5-bromo-2-but-3-ynoxybenzenesulfonamide |
| SMILES | C#CCCOc1ccc(Br)cc1S(N)(=O)=O |
| InChI | InChI=1S/C10H10BrNO3S/c1-2-3-6-15-9-5-4-8(11)7-10(9)16(12,13)14/h1,4-5,7H,3,6H2,(H2,12,13,14) |
| InChIKey | JZIWLXBSYUOYGF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|