C12H13BrN2O3S2 — CID 82915384
5-bromo-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzenesulfonamide (PubChem CID 82915384) has the molecular formula C12H13BrN2O3S2 and a molecular weight of 377.29 g/mol. Its IUPAC name is 5-bromo-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzenesulfonamide.
| Compound Name | 5-bromo-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 82915384 |
| Molecular Formula | C12H13BrN2O3S2 |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | 5-bromo-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzenesulfonamide |
| SMILES | Cc1ncsc1CCOc1ccc(Br)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H13BrN2O3S2/c1-8-11(19-7-15-8)4-5-18-10-3-2-9(13)6-12(10)20(14,16)17/h2-3,6-7H,4-5H2,1H3,(H2,14,16,17) |
| InChIKey | LTXVXKVHOATELP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |