C13H10BrCl2NO3S — CID 62103693
5-bromo-2-[(3,4-dichlorophenyl)methoxy]benzenesulfonamide (PubChem CID 62103693) has the molecular formula C13H10BrCl2NO3S and a molecular weight of 411.10 g/mol. Its IUPAC name is 5-bromo-2-[(3,4-dichlorophenyl)methoxy]benzenesulfonamide.
| Compound Name | 5-bromo-2-[(3,4-dichlorophenyl)methoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 62103693 |
| Molecular Formula | C13H10BrCl2NO3S |
| Molecular Weight | 411.10 g/mol |
| Exact Mass | 408.89 |
| IUPAC Name | 5-bromo-2-[(3,4-dichlorophenyl)methoxy]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Br)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H10BrCl2NO3S/c14-9-2-4-12(13(6-9)21(17,18)19)20-7-8-1-3-10(15)11(16)5-8/h1-6H,7H2,(H2,17,18,19) |
| InChIKey | CWDZBWJLHRKWQX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.10 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |