C9H5BrF3NO — CID 58516372
4-bromo-2-isocyano-1-(2,2,2-trifluoroethoxy)benzene (PubChem CID 58516372) has the molecular formula C9H5BrF3NO and a molecular weight of 280.04 g/mol. Its IUPAC name is 4-bromo-2-isocyano-1-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 4-bromo-2-isocyano-1-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 58516372 |
| Molecular Formula | C9H5BrF3NO |
| Molecular Weight | 280.04 g/mol |
| Exact Mass | 278.95 |
| IUPAC Name | 4-bromo-2-isocyano-1-(2,2,2-trifluoroethoxy)benzene |
| SMILES | [C-]#[N+]c1cc(Br)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C9H5BrF3NO/c1-14-7-4-6(10)2-3-8(7)15-5-9(11,12)13/h2-4H,5H2 |
| InChIKey | ZZILXTUKOVGSEI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.04 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|