C10H11BrF3NO — CID 102946643
(1R)-1-[4-bromo-2-(2,2,2-trifluoroethoxy)phenyl]ethanamine (PubChem CID 102946643) has the molecular formula C10H11BrF3NO and a molecular weight of 298.10 g/mol. Its IUPAC name is (1R)-1-[4-bromo-2-(2,2,2-trifluoroethoxy)phenyl]ethanamine.
| Compound Name | (1R)-1-[4-bromo-2-(2,2,2-trifluoroethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 102946643 |
| Molecular Formula | C10H11BrF3NO |
| Molecular Weight | 298.10 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | (1R)-1-[4-bromo-2-(2,2,2-trifluoroethoxy)phenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(Br)cc1OCC(F)(F)F |
| InChI | InChI=1S/C10H11BrF3NO/c1-6(15)8-3-2-7(11)4-9(8)16-5-10(12,13)14/h2-4,6H,5,15H2,1H3/t6-/m1/s1 |
| InChIKey | HRFLRTXRHWCKGR-ZCFIWIBFSA-N |
| XLogP | 3.41 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.10 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |