C11H13BrF3NO2 — CID 106704814
(1R)-1-[4-bromo-2-(2,2,2-trifluoroethoxymethoxy)phenyl]ethanamine (PubChem CID 106704814) has the molecular formula C11H13BrF3NO2 and a molecular weight of 328.13 g/mol. Its IUPAC name is (1R)-1-[4-bromo-2-(2,2,2-trifluoroethoxymethoxy)phenyl]ethanamine.
| Compound Name | (1R)-1-[4-bromo-2-(2,2,2-trifluoroethoxymethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 106704814 |
| Molecular Formula | C11H13BrF3NO2 |
| Molecular Weight | 328.13 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | (1R)-1-[4-bromo-2-(2,2,2-trifluoroethoxymethoxy)phenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(Br)cc1OCOCC(F)(F)F |
| InChI | InChI=1S/C11H13BrF3NO2/c1-7(16)9-3-2-8(12)4-10(9)18-6-17-5-11(13,14)15/h2-4,7H,5-6,16H2,1H3/t7-/m1/s1 |
| InChIKey | CBVJOACKLLCTBH-SSDOTTSWSA-N |
| XLogP | 3.38 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.13 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|