C10H10BrF3O2 — CID 102948938
(1S)-1-[4-bromo-2-(2,2,2-trifluoroethoxy)phenyl]ethanol (PubChem CID 102948938) has the molecular formula C10H10BrF3O2 and a molecular weight of 299.09 g/mol. Its IUPAC name is (1S)-1-[4-bromo-2-(2,2,2-trifluoroethoxy)phenyl]ethanol.
| Compound Name | (1S)-1-[4-bromo-2-(2,2,2-trifluoroethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 102948938 |
| Molecular Formula | C10H10BrF3O2 |
| Molecular Weight | 299.09 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | (1S)-1-[4-bromo-2-(2,2,2-trifluoroethoxy)phenyl]ethanol |
| SMILES | C[C@H](O)c1ccc(Br)cc1OCC(F)(F)F |
| InChI | InChI=1S/C10H10BrF3O2/c1-6(15)8-3-2-7(11)4-9(8)16-5-10(12,13)14/h2-4,6,15H,5H2,1H3/t6-/m0/s1 |
| InChIKey | VZCWSHKSKRUPJB-LURJTMIESA-N |
| XLogP | 3.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.09 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |