C12H14BrF3O2 — CID 155928749
4-bromo-1-(2-methylpropoxy)-2-(2,2,2-trifluoroethoxy)benzene (PubChem CID 155928749) has the molecular formula C12H14BrF3O2 and a molecular weight of 327.14 g/mol. Its IUPAC name is 4-bromo-1-(2-methylpropoxy)-2-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 4-bromo-1-(2-methylpropoxy)-2-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 155928749 |
| Molecular Formula | C12H14BrF3O2 |
| Molecular Weight | 327.14 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 4-bromo-1-(2-methylpropoxy)-2-(2,2,2-trifluoroethoxy)benzene |
| SMILES | CC(C)COc1ccc(Br)cc1OCC(F)(F)F |
| InChI | InChI=1S/C12H14BrF3O2/c1-8(2)6-17-10-4-3-9(13)5-11(10)18-7-12(14,15)16/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | IGDRMQBZZURBGP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.14 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |