C15H25BrNO+ — CID 7366809
[5-bromo-2-(2-methylpropoxy)phenyl]methyl-tert-butylazanium (PubChem CID 7366809) has the molecular formula C15H25BrNO+ and a molecular weight of 315.28 g/mol. Its IUPAC name is [5-bromo-2-(2-methylpropoxy)phenyl]methyl-tert-butylazanium.
| Compound Name | [5-bromo-2-(2-methylpropoxy)phenyl]methyl-tert-butylazanium |
|---|---|
| PubChem CID | 7366809 |
| Molecular Formula | C15H25BrNO+ |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [5-bromo-2-(2-methylpropoxy)phenyl]methyl-tert-butylazanium |
| SMILES | CC(C)COc1ccc(Br)cc1C[NH2+]C(C)(C)C |
| InChI | InChI=1S/C15H24BrNO/c1-11(2)10-18-14-7-6-13(16)8-12(14)9-17-15(3,4)5/h6-8,11,17H,9-10H2,1-5H3/p+1 |
| InChIKey | HJDFSZBWSAPAJK-UHFFFAOYSA-O |
| XLogP | 3.35 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |