C13H16BrF3O2 — CID 61490739
5-(bromomethyl)-1,3-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene (PubChem CID 61490739) has the molecular formula C13H16BrF3O2 and a molecular weight of 341.17 g/mol. Its IUPAC name is 5-(bromomethyl)-1,3-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene.
| Compound Name | 5-(bromomethyl)-1,3-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 61490739 |
| Molecular Formula | C13H16BrF3O2 |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 5-(bromomethyl)-1,3-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene |
| SMILES | Cc1cc(CBr)cc(C)c1OCCOCC(F)(F)F |
| InChI | InChI=1S/C13H16BrF3O2/c1-9-5-11(7-14)6-10(2)12(9)19-4-3-18-8-13(15,16)17/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | ZBXQTVSRPAZMAU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|