C11H10Br3F3O2 — CID 107745646
1,3-dibromo-5-(bromomethyl)-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene (PubChem CID 107745646) has the molecular formula C11H10Br3F3O2 and a molecular weight of 470.91 g/mol. Its IUPAC name is 1,3-dibromo-5-(bromomethyl)-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene.
| Compound Name | 1,3-dibromo-5-(bromomethyl)-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 107745646 |
| Molecular Formula | C11H10Br3F3O2 |
| Molecular Weight | 470.91 g/mol |
| Exact Mass | 467.82 |
| IUPAC Name | 1,3-dibromo-5-(bromomethyl)-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene |
| SMILES | FC(F)(F)COCCOc1c(Br)cc(CBr)cc1Br |
| InChI | InChI=1S/C11H10Br3F3O2/c12-5-7-3-8(13)10(9(14)4-7)19-2-1-18-6-11(15,16)17/h3-4H,1-2,5-6H2 |
| InChIKey | MKGZZOSRQIBUJN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.91 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|