C9H7F6NO2S — CID 119007924
5-methyl-2,4-bis(trifluoromethyl)benzenesulfonamide (PubChem CID 119007924) has the molecular formula C9H7F6NO2S and a molecular weight of 307.22 g/mol. Its IUPAC name is 5-methyl-2,4-bis(trifluoromethyl)benzenesulfonamide.
| Compound Name | 5-methyl-2,4-bis(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119007924 |
| Molecular Formula | C9H7F6NO2S |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 5-methyl-2,4-bis(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1cc(S(N)(=O)=O)c(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C9H7F6NO2S/c1-4-2-7(19(16,17)18)6(9(13,14)15)3-5(4)8(10,11)12/h2-3H,1H3,(H2,16,17,18) |
| InChIKey | PYLXJADTSHYAJP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |