C32H52O3P+ — CID 70284253
bis(2,4-dibutyl-6-methylphenoxy)-ethyl-hydroxyphosphanium (PubChem CID 70284253) has the molecular formula C32H52O3P+ and a molecular weight of 515.74 g/mol. Its IUPAC name is bis(2,4-dibutyl-6-methylphenoxy)-ethyl-hydroxyphosphanium.
| Compound Name | bis(2,4-dibutyl-6-methylphenoxy)-ethyl-hydroxyphosphanium |
|---|---|
| PubChem CID | 70284253 |
| Molecular Formula | C32H52O3P+ |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.36 |
| IUPAC Name | bis(2,4-dibutyl-6-methylphenoxy)-ethyl-hydroxyphosphanium |
| SMILES | CCCCc1cc(C)c(O[P+](O)(CC)Oc2c(C)cc(CCCC)cc2CCCC)c(CCCC)c1 |
| InChI | InChI=1S/C32H52O3P/c1-8-13-17-27-21-25(6)31(29(23-27)19-15-10-3)34-36(33,12-5)35-32-26(7)22-28(18-14-9-2)24-30(32)20-16-11-4/h21-24,33H,8-20H2,1-7H3/q+1 |
| InChIKey | KCDUPFXHDZLWCT-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|