C12H17Br — CID 67873453
2-bromo-5-butyl-1,3-dimethylbenzene (PubChem CID 67873453) has the molecular formula C12H17Br and a molecular weight of 241.17 g/mol. Its IUPAC name is 2-bromo-5-butyl-1,3-dimethylbenzene.
| Compound Name | 2-bromo-5-butyl-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 67873453 |
| Molecular Formula | C12H17Br |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-bromo-5-butyl-1,3-dimethylbenzene |
| SMILES | CCCCc1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C12H17Br/c1-4-5-6-11-7-9(2)12(13)10(3)8-11/h7-8H,4-6H2,1-3H3 |
| InChIKey | JSYVNWLKPYFOHW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |