C13H21BrO — CID 144566079
3-(4-bromo-3,5-dimethylphenyl)propan-1-ol;ethane (PubChem CID 144566079) has the molecular formula C13H21BrO and a molecular weight of 273.21 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylphenyl)propan-1-ol;ethane.
| Compound Name | 3-(4-bromo-3,5-dimethylphenyl)propan-1-ol;ethane |
|---|---|
| PubChem CID | 144566079 |
| Molecular Formula | C13H21BrO |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylphenyl)propan-1-ol;ethane |
| SMILES | CC.Cc1cc(CCCO)cc(C)c1Br |
| InChI | InChI=1S/C11H15BrO.C2H6/c1-8-6-10(4-3-5-13)7-9(2)11(8)12;1-2/h6-7,13H,3-5H2,1-2H3;1-2H3 |
| InChIKey | HJYSNPLYNQRUEK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |