C30H45Br2I — CID 157139707
2-bromo-5-heptyl-1,3-dimethylbenzene;2-bromo-5-iodo-1,3-dimethylbenzene;hept-1-ene (PubChem CID 157139707) has the molecular formula C30H45Br2I and a molecular weight of 692.40 g/mol. Its IUPAC name is 2-bromo-5-heptyl-1,3-dimethylbenzene;2-bromo-5-iodo-1,3-dimethylbenzene;hept-1-ene.
| Compound Name | 2-bromo-5-heptyl-1,3-dimethylbenzene;2-bromo-5-iodo-1,3-dimethylbenzene;hept-1-ene |
|---|---|
| PubChem CID | 157139707 |
| Molecular Formula | C30H45Br2I |
| Molecular Weight | 692.40 g/mol |
| Exact Mass | 690.09 |
| IUPAC Name | 2-bromo-5-heptyl-1,3-dimethylbenzene;2-bromo-5-iodo-1,3-dimethylbenzene;hept-1-ene |
| SMILES | C=CCCCCC.CCCCCCCc1cc(C)c(Br)c(C)c1.Cc1cc(I)cc(C)c1Br |
| InChI | InChI=1S/C15H23Br.C8H8BrI.C7H14/c1-4-5-6-7-8-9-14-10-12(2)15(16)13(3)11-14;1-5-3-7(10)4-6(2)8(5)9;1-3-5-7-6-4-2/h10-11H,4-9H2,1-3H3;3-4H,1-2H3;3H,1,4-7H2,2H3 |
| InChIKey | AKAYKMZUDAPPAU-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.40 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|