C22H42O — CID 158537359
2-tert-butyl-6-methyl-4-(2-methylbutan-2-yl)phenol;methane;2-methylbutane (PubChem CID 158537359) has the molecular formula C22H42O and a molecular weight of 322.58 g/mol. Its IUPAC name is 2-tert-butyl-6-methyl-4-(2-methylbutan-2-yl)phenol;methane;2-methylbutane.
| Compound Name | 2-tert-butyl-6-methyl-4-(2-methylbutan-2-yl)phenol;methane;2-methylbutane |
|---|---|
| PubChem CID | 158537359 |
| Molecular Formula | C22H42O |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.32 |
| IUPAC Name | 2-tert-butyl-6-methyl-4-(2-methylbutan-2-yl)phenol;methane;2-methylbutane |
| SMILES | C.CCC(C)(C)c1cc(C)c(O)c(C(C)(C)C)c1.CCC(C)C |
| InChI | InChI=1S/C16H26O.C5H12.CH4/c1-8-16(6,7)12-9-11(2)14(17)13(10-12)15(3,4)5;1-4-5(2)3;/h9-10,17H,8H2,1-7H3;5H,4H2,1-3H3;1H4 |
| InChIKey | HOCIPKBGOGVIIG-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |