C41H48I4O8S2 — CID 10876948
[4-[2-[4-[3-(4-tert-butyl-2,6-diiodophenoxy)propylsulfonyloxy]phenyl]propan-2-yl]phenyl] 3-(4-tert-butyl-2,6-diiodophenoxy)propane-1-sulfonate (PubChem CID 10876948) has the molecular formula C41H48I4O8S2 and a molecular weight of 1240.58 g/mol. Its IUPAC name is [4-[2-[4-[3-(4-tert-butyl-2,6-diiodophenoxy)propylsulfonyloxy]phenyl]propan-2-yl]phenyl] 3-(4-tert-butyl-2,6-diiodophenoxy)propane-1-sulfonate.
| Compound Name | [4-[2-[4-[3-(4-tert-butyl-2,6-diiodophenoxy)propylsulfonyloxy]phenyl]propan-2-yl]phenyl] 3-(4-tert-butyl-2,6-diiodophenoxy)propane-1-sulfonate |
|---|---|
| PubChem CID | 10876948 |
| Molecular Formula | C41H48I4O8S2 |
| Molecular Weight | 1240.58 g/mol |
| Exact Mass | 1239.90 |
| IUPAC Name | [4-[2-[4-[3-(4-tert-butyl-2,6-diiodophenoxy)propylsulfonyloxy]phenyl]propan-2-yl]phenyl] 3-(4-tert-butyl-2,6-diiodophenoxy)propane-1-sulfonate |
| SMILES | CC(C)(C)c1cc(I)c(OCCCS(=O)(=O)Oc2ccc(C(C)(C)c3ccc(OS(=O)(=O)CCCOc4c(I)cc(C(C)(C)C)cc4I)cc3)cc2)c(I)c1 |
| InChI | InChI=1S/C41H48I4O8S2/c1-39(2,3)29-23-33(42)37(34(43)24-29)50-19-9-21-54(46,47)52-31-15-11-27(12-16-31)41(7,8)28-13-17-32(18-14-28)53-55(48,49)22-10-20-51-38-35(44)25-30(26-36(38)45)40(4,5)6/h11-18,23-26H,9-10,19-22H2,1-8H3 |
| InChIKey | GCRWKAPSOWDBRL-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1240.58 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|