C18H23NaO5S — CID 173434374
sodium;hydride;2-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]ethanesulfonic acid (PubChem CID 173434374) has the molecular formula C18H23NaO5S and a molecular weight of 374.43 g/mol. Its IUPAC name is sodium;hydride;2-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]ethanesulfonic acid.
| Compound Name | sodium;hydride;2-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 173434374 |
| Molecular Formula | C18H23NaO5S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | sodium;hydride;2-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]ethanesulfonic acid |
| SMILES | COc1ccc(C(C)(C)c2ccc(OCCS(=O)(=O)O)cc2)cc1.[H-].[Na+] |
| InChI | InChI=1S/C18H22O5S.Na.H/c1-18(2,14-4-8-16(22-3)9-5-14)15-6-10-17(11-7-15)23-12-13-24(19,20)21;;/h4-11H,12-13H2,1-3H3,(H,19,20,21);;/q;+1;-1 |
| InChIKey | XYHCFAKXFJOQHO-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|