C29H38O4 — CID 161274119
5-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]-2-methylpent-1-en-3-one;2-methylhex-1-en-3-one (PubChem CID 161274119) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is 5-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]-2-methylpent-1-en-3-one;2-methylhex-1-en-3-one.
| Compound Name | 5-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]-2-methylpent-1-en-3-one;2-methylhex-1-en-3-one |
|---|---|
| PubChem CID | 161274119 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 5-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]-2-methylpent-1-en-3-one;2-methylhex-1-en-3-one |
| SMILES | C=C(C)C(=O)CCC.C=C(C)C(=O)CCOc1ccc(C(C)(C)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H26O3.C7H12O/c1-16(2)21(23)14-15-25-20-12-8-18(9-13-20)22(3,4)17-6-10-19(24-5)11-7-17;1-4-5-7(8)6(2)3/h6-13H,1,14-15H2,2-5H3;2,4-5H2,1,3H3 |
| InChIKey | VEFAUOIJHGKBIP-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|