C28H34O6 — CID 69305186
[2-hydroxy-3-[4-[2-[4-(4-methyl-3-oxopent-4-enoxy)phenyl]propan-2-yl]phenoxy]propyl] but-2-enoate (PubChem CID 69305186) has the molecular formula C28H34O6 and a molecular weight of 466.57 g/mol. Its IUPAC name is [2-hydroxy-3-[4-[2-[4-(4-methyl-3-oxopent-4-enoxy)phenyl]propan-2-yl]phenoxy]propyl] but-2-enoate.
| Compound Name | [2-hydroxy-3-[4-[2-[4-(4-methyl-3-oxopent-4-enoxy)phenyl]propan-2-yl]phenoxy]propyl] but-2-enoate |
|---|---|
| PubChem CID | 69305186 |
| Molecular Formula | C28H34O6 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | [2-hydroxy-3-[4-[2-[4-(4-methyl-3-oxopent-4-enoxy)phenyl]propan-2-yl]phenoxy]propyl] but-2-enoate |
| SMILES | C=C(C)C(=O)CCOc1ccc(C(C)(C)c2ccc(OCC(O)COC(=O)C=CC)cc2)cc1 |
| InChI | InChI=1S/C28H34O6/c1-6-7-27(31)34-19-23(29)18-33-25-14-10-22(11-15-25)28(4,5)21-8-12-24(13-9-21)32-17-16-26(30)20(2)3/h6-15,23,29H,2,16-19H2,1,3-5H3 |
| InChIKey | KXGLQPODDZRAJA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|