C30H36O10 — CID 70177554
[3-[4-[2-[4-[2-carboxyoxy-3-(2-methylprop-2-enoyloxy)propoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 70177554) has the molecular formula C30H36O10 and a molecular weight of 556.61 g/mol. Its IUPAC name is [3-[4-[2-[4-[2-carboxyoxy-3-(2-methylprop-2-enoyloxy)propoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[4-[2-[4-[2-carboxyoxy-3-(2-methylprop-2-enoyloxy)propoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 70177554 |
| Molecular Formula | C30H36O10 |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | [3-[4-[2-[4-[2-carboxyoxy-3-(2-methylprop-2-enoyloxy)propoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COc1ccc(C(C)(C)c2ccc(OCC(COC(=O)C(=C)C)OC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H36O10/c1-19(2)27(32)38-16-23(31)15-36-24-11-7-21(8-12-24)30(5,6)22-9-13-25(14-10-22)37-17-26(40-29(34)35)18-39-28(33)20(3)4/h7-14,23,26,31H,1,3,15-18H2,2,4-6H3,(H,34,35) |
| InChIKey | UYQVTZTVEICOMP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|