C35H36O10 — CID 139915038
[2-hydroxy-3-[4-[2-[4-(2-hydroxy-3-phenoxycarbonyloxypropoxy)phenyl]propan-2-yl]phenoxy]propyl] phenyl carbonate (PubChem CID 139915038) has the molecular formula C35H36O10 and a molecular weight of 616.66 g/mol. Its IUPAC name is [2-hydroxy-3-[4-[2-[4-(2-hydroxy-3-phenoxycarbonyloxypropoxy)phenyl]propan-2-yl]phenoxy]propyl] phenyl carbonate.
| Compound Name | [2-hydroxy-3-[4-[2-[4-(2-hydroxy-3-phenoxycarbonyloxypropoxy)phenyl]propan-2-yl]phenoxy]propyl] phenyl carbonate |
|---|---|
| PubChem CID | 139915038 |
| Molecular Formula | C35H36O10 |
| Molecular Weight | 616.66 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | [2-hydroxy-3-[4-[2-[4-(2-hydroxy-3-phenoxycarbonyloxypropoxy)phenyl]propan-2-yl]phenoxy]propyl] phenyl carbonate |
| SMILES | CC(C)(c1ccc(OCC(O)COC(=O)Oc2ccccc2)cc1)c1ccc(OCC(O)COC(=O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C35H36O10/c1-35(2,25-13-17-29(18-14-25)40-21-27(36)23-42-33(38)44-31-9-5-3-6-10-31)26-15-19-30(20-16-26)41-22-28(37)24-43-34(39)45-32-11-7-4-8-12-32/h3-20,27-28,36-37H,21-24H2,1-2H3 |
| InChIKey | MDUPLKKKEAGAHL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|