About (2-hydroxy-3-phenoxypropyl) methylphosphanylformate
(2-hydroxy-3-phenoxypropyl) methylphosphanylformate (PubChem CID 59790512) has the molecular formula C11H15O4P
and a molecular weight of 242.21 g/mol. Its IUPAC name is (2-hydroxy-3-phenoxypropyl) methylphosphanylformate.
Molecular Properties
| Compound Name | (2-hydroxy-3-phenoxypropyl) methylphosphanylformate |
| PubChem CID | 59790512 |
| Molecular Formula | C11H15O4P |
| Molecular Weight | 242.21 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | (2-hydroxy-3-phenoxypropyl) methylphosphanylformate |
| SMILES | CPC(=O)OCC(O)COc1ccccc1 |
| InChI | InChI=1S/C11H15O4P/c1-16-11(13)15-8-9(12)7-14-10-5-3-2-4-6-10/h2-6,9,12,16H,7-8H2,1H3 |
| InChIKey | CUFJGACHKMSPIK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.21 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxy-3-phenoxypropyl) methylphosphanylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-3-phenoxypropyl) methylphosphanylformate?
The IUPAC name of (2-hydroxy-3-phenoxypropyl) methylphosphanylformate (CID 59790512) is (2-hydroxy-3-phenoxypropyl) methylphosphanylformate.
What is the SMILES notation for (2-hydroxy-3-phenoxypropyl) methylphosphanylformate?
The canonical SMILES for (2-hydroxy-3-phenoxypropyl) methylphosphanylformate is CPC(=O)OCC(O)COc1ccccc1.
What is the InChIKey of (2-hydroxy-3-phenoxypropyl) methylphosphanylformate?
The InChIKey is CUFJGACHKMSPIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15O4P/c1-16-11(13)15-8-9(12)7-14-10-5-3-2-4-6-10/h2-6,9,12,16H,7-8H2,1H3.
What are the key properties of (2-hydroxy-3-phenoxypropyl) methylphosphanylformate?
(2-hydroxy-3-phenoxypropyl) methylphosphanylformate has a molecular weight of 242.21 g/mol, XLogP of 1.87, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-3-phenoxypropyl) methylphosphanylformate is sourced from PubChem (CID 59790512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).