C14H18O4 — CID 149436973
(2-hydroxy-3-phenoxypropyl) 2-methylidenebutanoate (PubChem CID 149436973) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (2-hydroxy-3-phenoxypropyl) 2-methylidenebutanoate.
| Compound Name | (2-hydroxy-3-phenoxypropyl) 2-methylidenebutanoate |
|---|---|
| PubChem CID | 149436973 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (2-hydroxy-3-phenoxypropyl) 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)OCC(O)COc1ccccc1 |
| InChI | InChI=1S/C14H18O4/c1-3-11(2)14(16)18-10-12(15)9-17-13-7-5-4-6-8-13/h4-8,12,15H,2-3,9-10H2,1H3 |
| InChIKey | KXSSRGPLFMDYOC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|