C24H36O7 — CID 67511890
[2-hydroxy-3-[[4-[(2-hydroxy-3-phenoxypropoxy)methyl]cyclohexyl]methoxy]propyl] 2-methylprop-2-enoate (PubChem CID 67511890) has the molecular formula C24H36O7 and a molecular weight of 436.55 g/mol. Its IUPAC name is [2-hydroxy-3-[[4-[(2-hydroxy-3-phenoxypropoxy)methyl]cyclohexyl]methoxy]propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-[[4-[(2-hydroxy-3-phenoxypropoxy)methyl]cyclohexyl]methoxy]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67511890 |
| Molecular Formula | C24H36O7 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | [2-hydroxy-3-[[4-[(2-hydroxy-3-phenoxypropoxy)methyl]cyclohexyl]methoxy]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COCC1CCC(COCC(O)COc2ccccc2)CC1 |
| InChI | InChI=1S/C24H36O7/c1-18(2)24(27)31-17-22(26)15-29-13-20-10-8-19(9-11-20)12-28-14-21(25)16-30-23-6-4-3-5-7-23/h3-7,19-22,25-26H,1,8-17H2,2H3 |
| InChIKey | CZSOXBJJWODZDB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|