C13H15IO4 — CID 171726363
[2-hydroxy-3-(2-iodophenoxy)propyl] 2-methylprop-2-enoate (PubChem CID 171726363) has the molecular formula C13H15IO4 and a molecular weight of 362.16 g/mol. Its IUPAC name is [2-hydroxy-3-(2-iodophenoxy)propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-(2-iodophenoxy)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 171726363 |
| Molecular Formula | C13H15IO4 |
| Molecular Weight | 362.16 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | [2-hydroxy-3-(2-iodophenoxy)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COc1ccccc1I |
| InChI | InChI=1S/C13H15IO4/c1-9(2)13(16)18-8-10(15)7-17-12-6-4-3-5-11(12)14/h3-6,10,15H,1,7-8H2,2H3 |
| InChIKey | MSBXJNWASPKYMT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.16 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|