C13H13I3O4 — CID 156533989
[2-hydroxy-3-(2,3,5-triiodophenoxy)propyl] 2-methylprop-2-enoate (PubChem CID 156533989) has the molecular formula C13H13I3O4 and a molecular weight of 613.96 g/mol. Its IUPAC name is [2-hydroxy-3-(2,3,5-triiodophenoxy)propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-(2,3,5-triiodophenoxy)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 156533989 |
| Molecular Formula | C13H13I3O4 |
| Molecular Weight | 613.96 g/mol |
| Exact Mass | 613.79 |
| IUPAC Name | [2-hydroxy-3-(2,3,5-triiodophenoxy)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COc1cc(I)cc(I)c1I |
| InChI | InChI=1S/C13H13I3O4/c1-7(2)13(18)20-6-9(17)5-19-11-4-8(14)3-10(15)12(11)16/h3-4,9,17H,1,5-6H2,2H3 |
| InChIKey | UUXDRRYFTDGEHX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.96 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|