C13H14Br2O4 — CID 139844486
[3-(2,3-dibromophenoxy)-2-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 139844486) has the molecular formula C13H14Br2O4 and a molecular weight of 394.06 g/mol. Its IUPAC name is [3-(2,3-dibromophenoxy)-2-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [3-(2,3-dibromophenoxy)-2-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139844486 |
| Molecular Formula | C13H14Br2O4 |
| Molecular Weight | 394.06 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | [3-(2,3-dibromophenoxy)-2-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COc1cccc(Br)c1Br |
| InChI | InChI=1S/C13H14Br2O4/c1-8(2)13(17)19-7-9(16)6-18-11-5-3-4-10(14)12(11)15/h3-5,9,16H,1,6-7H2,2H3 |
| InChIKey | TUVQHERZICKJJX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.06 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|