C14H16Br2O4 — CID 70468740
[3-[4-(dibromomethyl)phenoxy]-2-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 70468740) has the molecular formula C14H16Br2O4 and a molecular weight of 408.09 g/mol. Its IUPAC name is [3-[4-(dibromomethyl)phenoxy]-2-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[4-(dibromomethyl)phenoxy]-2-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 70468740 |
| Molecular Formula | C14H16Br2O4 |
| Molecular Weight | 408.09 g/mol |
| Exact Mass | 405.94 |
| IUPAC Name | [3-[4-(dibromomethyl)phenoxy]-2-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COc1ccc(C(Br)Br)cc1 |
| InChI | InChI=1S/C14H16Br2O4/c1-9(2)14(18)20-8-11(17)7-19-12-5-3-10(4-6-12)13(15)16/h3-6,11,13,17H,1,7-8H2,2H3 |
| InChIKey | AZUBXWUIRZTGNF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.09 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|