C15H15Cl2IO4 — CID 141076071
(2-iodophenyl) 2,4-dichloro-5-(2-methylprop-2-enoyloxy)pentanoate (PubChem CID 141076071) has the molecular formula C15H15Cl2IO4 and a molecular weight of 457.09 g/mol. Its IUPAC name is (2-iodophenyl) 2,4-dichloro-5-(2-methylprop-2-enoyloxy)pentanoate.
| Compound Name | (2-iodophenyl) 2,4-dichloro-5-(2-methylprop-2-enoyloxy)pentanoate |
|---|---|
| PubChem CID | 141076071 |
| Molecular Formula | C15H15Cl2IO4 |
| Molecular Weight | 457.09 g/mol |
| Exact Mass | 455.94 |
| IUPAC Name | (2-iodophenyl) 2,4-dichloro-5-(2-methylprop-2-enoyloxy)pentanoate |
| SMILES | C=C(C)C(=O)OCC(Cl)CC(Cl)C(=O)Oc1ccccc1I |
| InChI | InChI=1S/C15H15Cl2IO4/c1-9(2)14(19)21-8-10(16)7-11(17)15(20)22-13-6-4-3-5-12(13)18/h3-6,10-11H,1,7-8H2,2H3 |
| InChIKey | JKWIRHNDYHJRCJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.09 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|