C10H15LiO4S — CID 173469296
lithium;(4-tert-butylphenyl) hydrogen sulfate;hydride (PubChem CID 173469296) has the molecular formula C10H15LiO4S and a molecular weight of 238.23 g/mol. Its IUPAC name is lithium;(4-tert-butylphenyl) hydrogen sulfate;hydride.
| Compound Name | lithium;(4-tert-butylphenyl) hydrogen sulfate;hydride |
|---|---|
| PubChem CID | 173469296 |
| Molecular Formula | C10H15LiO4S |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | lithium;(4-tert-butylphenyl) hydrogen sulfate;hydride |
| SMILES | CC(C)(C)c1ccc(OS(=O)(=O)O)cc1.[H-].[Li+] |
| InChI | InChI=1S/C10H14O4S.Li.H/c1-10(2,3)8-4-6-9(7-5-8)14-15(11,12)13;;/h4-7H,1-3H3,(H,11,12,13);;/q;+1;-1 |
| InChIKey | ZCBBKIGKDRPKQY-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|