C14H11I2O6S- — CID 170531401
4-[2-(4-hydroxy-2,6-diiodophenoxy)ethoxy]benzenesulfonate (PubChem CID 170531401) has the molecular formula C14H11I2O6S- and a molecular weight of 561.11 g/mol. Its IUPAC name is 4-[2-(4-hydroxy-2,6-diiodophenoxy)ethoxy]benzenesulfonate.
| Compound Name | 4-[2-(4-hydroxy-2,6-diiodophenoxy)ethoxy]benzenesulfonate |
|---|---|
| PubChem CID | 170531401 |
| Molecular Formula | C14H11I2O6S- |
| Molecular Weight | 561.11 g/mol |
| Exact Mass | 560.84 |
| IUPAC Name | 4-[2-(4-hydroxy-2,6-diiodophenoxy)ethoxy]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(OCCOc2c(I)cc(O)cc2I)cc1 |
| InChI | InChI=1S/C14H12I2O6S/c15-12-7-9(17)8-13(16)14(12)22-6-5-21-10-1-3-11(4-2-10)23(18,19)20/h1-4,7-8,17H,5-6H2,(H,18,19,20)/p-1 |
| InChIKey | VDJNFZVPSKRZFP-UHFFFAOYSA-M |
| XLogP | 2.96 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.11 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|