C43H54I2O2 — CID 178068798
2,4-ditert-butyl-1-[4-[3-[4-(2,4-ditert-butylphenyl)-2-iodophenoxy]propoxy]-3-iodophenyl]benzene (PubChem CID 178068798) has the molecular formula C43H54I2O2 and a molecular weight of 856.71 g/mol. Its IUPAC name is 2,4-ditert-butyl-1-[4-[3-[4-(2,4-ditert-butylphenyl)-2-iodophenoxy]propoxy]-3-iodophenyl]benzene.
| Compound Name | 2,4-ditert-butyl-1-[4-[3-[4-(2,4-ditert-butylphenyl)-2-iodophenoxy]propoxy]-3-iodophenyl]benzene |
|---|---|
| PubChem CID | 178068798 |
| Molecular Formula | C43H54I2O2 |
| Molecular Weight | 856.71 g/mol |
| Exact Mass | 856.22 |
| IUPAC Name | 2,4-ditert-butyl-1-[4-[3-[4-(2,4-ditert-butylphenyl)-2-iodophenoxy]propoxy]-3-iodophenyl]benzene |
| SMILES | CC(C)(C)c1ccc(-c2ccc(OCCCOc3ccc(-c4ccc(C(C)(C)C)cc4C(C)(C)C)cc3I)c(I)c2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C43H54I2O2/c1-40(2,3)30-16-18-32(34(26-30)42(7,8)9)28-14-20-38(36(44)24-28)46-22-13-23-47-39-21-15-29(25-37(39)45)33-19-17-31(41(4,5)6)27-35(33)43(10,11)12/h14-21,24-27H,13,22-23H2,1-12H3 |
| InChIKey | WUXBDBSZVKUREE-UHFFFAOYSA-N |
| XLogP | 13.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.71 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|