C21H35NO — CID 56829654
4-[2-(2,4-ditert-butylphenoxy)ethyl]piperidine (PubChem CID 56829654) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is 4-[2-(2,4-ditert-butylphenoxy)ethyl]piperidine.
| Compound Name | 4-[2-(2,4-ditert-butylphenoxy)ethyl]piperidine |
|---|---|
| PubChem CID | 56829654 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | 4-[2-(2,4-ditert-butylphenoxy)ethyl]piperidine |
| SMILES | CC(C)(C)c1ccc(OCCC2CCNCC2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H35NO/c1-20(2,3)17-7-8-19(18(15-17)21(4,5)6)23-14-11-16-9-12-22-13-10-16/h7-8,15-16,22H,9-14H2,1-6H3 |
| InChIKey | LVWLFCOQUZXELJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |