C19H31NO — CID 63914429
1-cyclopropyl-2-(2,4-ditert-butylphenoxy)ethanamine (PubChem CID 63914429) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2,4-ditert-butylphenoxy)ethanamine.
| Compound Name | 1-cyclopropyl-2-(2,4-ditert-butylphenoxy)ethanamine |
|---|---|
| PubChem CID | 63914429 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 1-cyclopropyl-2-(2,4-ditert-butylphenoxy)ethanamine |
| SMILES | CC(C)(C)c1ccc(OCC(N)C2CC2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H31NO/c1-18(2,3)14-9-10-17(15(11-14)19(4,5)6)21-12-16(20)13-7-8-13/h9-11,13,16H,7-8,12,20H2,1-6H3 |
| InChIKey | OAGNWTFAHYINLF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |