C20H27O3P — CID 175051245
[4-(2,4-ditert-butylphenyl)phenyl] dihydrogen phosphite (PubChem CID 175051245) has the molecular formula C20H27O3P and a molecular weight of 346.41 g/mol. Its IUPAC name is [4-(2,4-ditert-butylphenyl)phenyl] dihydrogen phosphite.
| Compound Name | [4-(2,4-ditert-butylphenyl)phenyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 175051245 |
| Molecular Formula | C20H27O3P |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | [4-(2,4-ditert-butylphenyl)phenyl] dihydrogen phosphite |
| SMILES | CC(C)(C)c1ccc(-c2ccc(OP(O)O)cc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H27O3P/c1-19(2,3)15-9-12-17(18(13-15)20(4,5)6)14-7-10-16(11-8-14)23-24(21)22/h7-13,21-22H,1-6H3 |
| InChIKey | ZWEADYICQNRWHJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|