C76H76O6P2 — CID 140827255
[2-[2-bis(4-phenylphenoxy)phosphanyloxy-3,5-ditert-butylphenyl]-4,6-ditert-butylphenyl] bis(4-phenylphenyl) phosphite (PubChem CID 140827255) has the molecular formula C76H76O6P2 and a molecular weight of 1147.39 g/mol. Its IUPAC name is [2-[2-bis(4-phenylphenoxy)phosphanyloxy-3,5-ditert-butylphenyl]-4,6-ditert-butylphenyl] bis(4-phenylphenyl) phosphite.
| Compound Name | [2-[2-bis(4-phenylphenoxy)phosphanyloxy-3,5-ditert-butylphenyl]-4,6-ditert-butylphenyl] bis(4-phenylphenyl) phosphite |
|---|---|
| PubChem CID | 140827255 |
| Molecular Formula | C76H76O6P2 |
| Molecular Weight | 1147.39 g/mol |
| Exact Mass | 1146.51 |
| IUPAC Name | [2-[2-bis(4-phenylphenoxy)phosphanyloxy-3,5-ditert-butylphenyl]-4,6-ditert-butylphenyl] bis(4-phenylphenyl) phosphite |
| SMILES | CC(C)(C)c1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2OP(Oc2ccc(-c3ccccc3)cc2)Oc2ccc(-c3ccccc3)cc2)c(OP(Oc2ccc(-c3ccccc3)cc2)Oc2ccc(-c3ccccc3)cc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C76H76O6P2/c1-73(2,3)61-49-67(71(69(51-61)75(7,8)9)81-83(77-63-41-33-57(34-42-63)53-25-17-13-18-26-53)78-64-43-35-58(36-44-64)54-27-19-14-20-28-54)68-50-62(74(4,5)6)52-70(76(10,11)12)72(68)82-84(79-65-45-37-59(38-46-65)55-29-21-15-22-30-55)80-66-47-39-60(40-48-66)56-31-23-16-24-32-56/h13-52H,1-12H3 |
| InChIKey | BPZLSLSXYQODGA-UHFFFAOYSA-N |
| XLogP | 22.74 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1147.39 |
| LogP ≤ 5 | 22.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|