C48H56O4P2 — CID 21130823
[2,4-ditert-butyl-6-(3,5-ditert-butyl-2-naphthalen-2-yloxyphosphanyloxyphenyl)phenoxy]-naphthalen-2-yloxyphosphane (PubChem CID 21130823) has the molecular formula C48H56O4P2 and a molecular weight of 758.92 g/mol. Its IUPAC name is [2,4-ditert-butyl-6-(3,5-ditert-butyl-2-naphthalen-2-yloxyphosphanyloxyphenyl)phenoxy]-naphthalen-2-yloxyphosphane.
| Compound Name | [2,4-ditert-butyl-6-(3,5-ditert-butyl-2-naphthalen-2-yloxyphosphanyloxyphenyl)phenoxy]-naphthalen-2-yloxyphosphane |
|---|---|
| PubChem CID | 21130823 |
| Molecular Formula | C48H56O4P2 |
| Molecular Weight | 758.92 g/mol |
| Exact Mass | 758.37 |
| IUPAC Name | [2,4-ditert-butyl-6-(3,5-ditert-butyl-2-naphthalen-2-yloxyphosphanyloxyphenyl)phenoxy]-naphthalen-2-yloxyphosphane |
| SMILES | CC(C)(C)c1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2OPOc2ccc3ccccc3c2)c(OPOc2ccc3ccccc3c2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C48H56O4P2/c1-45(2,3)35-27-39(43(41(29-35)47(7,8)9)51-53-49-37-23-21-31-17-13-15-19-33(31)25-37)40-28-36(46(4,5)6)30-42(48(10,11)12)44(40)52-54-50-38-24-22-32-18-14-16-20-34(32)26-38/h13-30,53-54H,1-12H3 |
| InChIKey | XXJXZFJMOCFNDI-UHFFFAOYSA-N |
| XLogP | 14.78 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.92 |
| LogP ≤ 5 | 14.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|