C17H24O — CID 50886344
2,4-ditert-butyl-1-prop-2-ynoxybenzene (PubChem CID 50886344) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is 2,4-ditert-butyl-1-prop-2-ynoxybenzene.
| Compound Name | 2,4-ditert-butyl-1-prop-2-ynoxybenzene |
|---|---|
| PubChem CID | 50886344 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 2,4-ditert-butyl-1-prop-2-ynoxybenzene |
| SMILES | C#CCOc1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C17H24O/c1-8-11-18-15-10-9-13(16(2,3)4)12-14(15)17(5,6)7/h1,9-10,12H,11H2,2-7H3 |
| InChIKey | CFAFSCUZMGZZNL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|