C25H39PSi — CID 15773777
ethynyl-(2,4,6-tritert-butylphenyl)-(2-trimethylsilylethynyl)phosphane (PubChem CID 15773777) has the molecular formula C25H39PSi and a molecular weight of 398.65 g/mol. Its IUPAC name is ethynyl-(2,4,6-tritert-butylphenyl)-(2-trimethylsilylethynyl)phosphane.
| Compound Name | ethynyl-(2,4,6-tritert-butylphenyl)-(2-trimethylsilylethynyl)phosphane |
|---|---|
| PubChem CID | 15773777 |
| Molecular Formula | C25H39PSi |
| Molecular Weight | 398.65 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | ethynyl-(2,4,6-tritert-butylphenyl)-(2-trimethylsilylethynyl)phosphane |
| SMILES | C#CP(C#C[Si](C)(C)C)c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C25H39PSi/c1-14-26(15-16-27(11,12)13)22-20(24(5,6)7)17-19(23(2,3)4)18-21(22)25(8,9)10/h1,17-18H,2-13H3 |
| InChIKey | JQTMXZARALHVFM-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.65 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|