C21H32ClOP — CID 134879567
chloro-prop-2-ynyl-(2,4,6-tritert-butylphenoxy)phosphane (PubChem CID 134879567) has the molecular formula C21H32ClOP and a molecular weight of 366.91 g/mol. Its IUPAC name is chloro-prop-2-ynyl-(2,4,6-tritert-butylphenoxy)phosphane.
| Compound Name | chloro-prop-2-ynyl-(2,4,6-tritert-butylphenoxy)phosphane |
|---|---|
| PubChem CID | 134879567 |
| Molecular Formula | C21H32ClOP |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | chloro-prop-2-ynyl-(2,4,6-tritert-butylphenoxy)phosphane |
| SMILES | C#CCP(Cl)Oc1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C21H32ClOP/c1-11-12-24(22)23-18-16(20(5,6)7)13-15(19(2,3)4)14-17(18)21(8,9)10/h1,13-14H,12H2,2-10H3 |
| InChIKey | SUUYZSRRMUUXQG-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|