C28H40Cl3O2P — CID 23331256
chloro-bis(2,6-ditert-butyl-4-chlorophenoxy)phosphane (PubChem CID 23331256) has the molecular formula C28H40Cl3O2P and a molecular weight of 545.96 g/mol. Its IUPAC name is chloro-bis(2,6-ditert-butyl-4-chlorophenoxy)phosphane.
| Compound Name | chloro-bis(2,6-ditert-butyl-4-chlorophenoxy)phosphane |
|---|---|
| PubChem CID | 23331256 |
| Molecular Formula | C28H40Cl3O2P |
| Molecular Weight | 545.96 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | chloro-bis(2,6-ditert-butyl-4-chlorophenoxy)phosphane |
| SMILES | CC(C)(C)c1cc(Cl)cc(C(C)(C)C)c1OP(Cl)Oc1c(C(C)(C)C)cc(Cl)cc1C(C)(C)C |
| InChI | InChI=1S/C28H40Cl3O2P/c1-25(2,3)19-13-17(29)14-20(26(4,5)6)23(19)32-34(31)33-24-21(27(7,8)9)15-18(30)16-22(24)28(10,11)12/h13-16H,1-12H3 |
| InChIKey | GRYGDASYNYUEHQ-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.96 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|