C29H47PSi2 — CID 102522485
1,5-bis(trimethylsilyl)penta-2,4-diynylidene-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 102522485) has the molecular formula C29H47PSi2 and a molecular weight of 482.84 g/mol. Its IUPAC name is 1,5-bis(trimethylsilyl)penta-2,4-diynylidene-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | 1,5-bis(trimethylsilyl)penta-2,4-diynylidene-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 102522485 |
| Molecular Formula | C29H47PSi2 |
| Molecular Weight | 482.84 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | 1,5-bis(trimethylsilyl)penta-2,4-diynylidene-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(/P=C(\C#CC#C[Si](C)(C)C)[Si](C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H47PSi2/c1-27(2,3)22-20-23(28(4,5)6)26(24(21-22)29(7,8)9)30-25(32(13,14)15)18-16-17-19-31(10,11)12/h20-21H,1-15H3 |
| InChIKey | XFSDGWLVZDZJFI-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.84 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|