C26H36BrPS — CID 134871332
[bromo-(4-methylphenyl)sulfanylmethylidene]-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 134871332) has the molecular formula C26H36BrPS and a molecular weight of 491.52 g/mol. Its IUPAC name is [bromo-(4-methylphenyl)sulfanylmethylidene]-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | [bromo-(4-methylphenyl)sulfanylmethylidene]-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 134871332 |
| Molecular Formula | C26H36BrPS |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | [bromo-(4-methylphenyl)sulfanylmethylidene]-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | Cc1ccc(S/C(Br)=P/c2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H36BrPS/c1-17-11-13-19(14-12-17)29-23(27)28-22-20(25(5,6)7)15-18(24(2,3)4)16-21(22)26(8,9)10/h11-16H,1-10H3 |
| InChIKey | TXZDZNLCRBLTIO-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|