C64H72P2 — CID 102172132
[1-phenyl-5-[4-[5-phenyl-5-(2,4,6-tritert-butylphenyl)phosphanylidenepenta-1,3-diynyl]phenyl]penta-2,4-diynylidene]-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 102172132) has the molecular formula C64H72P2 and a molecular weight of 903.23 g/mol. Its IUPAC name is [1-phenyl-5-[4-[5-phenyl-5-(2,4,6-tritert-butylphenyl)phosphanylidenepenta-1,3-diynyl]phenyl]penta-2,4-diynylidene]-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | [1-phenyl-5-[4-[5-phenyl-5-(2,4,6-tritert-butylphenyl)phosphanylidenepenta-1,3-diynyl]phenyl]penta-2,4-diynylidene]-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 102172132 |
| Molecular Formula | C64H72P2 |
| Molecular Weight | 903.23 g/mol |
| Exact Mass | 902.51 |
| IUPAC Name | [1-phenyl-5-[4-[5-phenyl-5-(2,4,6-tritert-butylphenyl)phosphanylidenepenta-1,3-diynyl]phenyl]penta-2,4-diynylidene]-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(/P=C(\C#CC#Cc2ccc(C#CC#C/C(=P\c3c(C(C)(C)C)cc(C(C)(C)C)cc3C(C)(C)C)c3ccccc3)cc2)c2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C64H72P2/c1-59(2,3)49-41-51(61(7,8)9)57(52(42-49)62(10,11)12)65-55(47-31-21-19-22-32-47)35-27-25-29-45-37-39-46(40-38-45)30-26-28-36-56(48-33-23-20-24-34-48)66-58-53(63(13,14)15)43-50(60(4,5)6)44-54(58)64(16,17)18/h19-24,31-34,37-44H,1-18H3 |
| InChIKey | KKIXZQXDIDKNCG-UHFFFAOYSA-N |
| XLogP | 15.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.23 |
| LogP ≤ 5 | 15.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|